Organic acids and derivatives
Filtered Search Results
Methyl 2-Methoxyphenylacetate 98.0+%, TCI America™
CAS: 27798-60-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.20 MDL Number: MFCD02093479 InChI Key: BNQRSYFOIRGRKV-UHFFFAOYSA-N Synonym: 2-Methoxyphenylacetic Acid Methyl Ester PubChem CID: 99590 IUPAC Name: methyl 2-(2-methoxyphenyl)acetate SMILES: COC(=O)CC1=CC=CC=C1OC
| PubChem CID | 99590 |
|---|---|
| CAS | 27798-60-3 |
| Molecular Weight (g/mol) | 180.20 |
| MDL Number | MFCD02093479 |
| SMILES | COC(=O)CC1=CC=CC=C1OC |
| Synonym | 2-Methoxyphenylacetic Acid Methyl Ester |
| IUPAC Name | methyl 2-(2-methoxyphenyl)acetate |
| InChI Key | BNQRSYFOIRGRKV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Dimethyl cis-4-Cyclohexene-1,2-dicarboxylate 97.0+%, TCI America™
CAS: 4841-84-3 Molecular Formula: C10H14O4 Molecular Weight (g/mol): 198.218 MDL Number: MFCD00209581 InChI Key: DVVAGRMJGUQHLI-OCAPTIKFSA-N Synonym: dimethyl cis-4-cyclohexene-1,2-dicarboxylate,dimethyl cis-1,2,3,6-tetrahydrophthalate,cis-dimethyl cyclohex-4-ene-1,2-dicarboxylate,dimethylcis-4-cyclohexene-1,2-dicarboxylate,1r, 6s-methyl 6-methoxycarbonyl-3-cyclohexenecarboxylate,4-cyclohexene-1alpha,2alpha-dicarboxylic acid dimethyl ester,1,2-dimethyl 1r,2s-cyclohex-4-ene-1,2-dicarboxylate,4-cyclohexene-1,2-dicarboxylicacid, dimethyl ester, 1r,2s-rel PubChem CID: 10867283 IUPAC Name: dimethyl (1R,2S)-cyclohex-4-ene-1,2-dicarboxylate SMILES: COC(=O)C1CC=CCC1C(=O)OC
| PubChem CID | 10867283 |
|---|---|
| CAS | 4841-84-3 |
| Molecular Weight (g/mol) | 198.218 |
| MDL Number | MFCD00209581 |
| SMILES | COC(=O)C1CC=CCC1C(=O)OC |
| Synonym | dimethyl cis-4-cyclohexene-1,2-dicarboxylate,dimethyl cis-1,2,3,6-tetrahydrophthalate,cis-dimethyl cyclohex-4-ene-1,2-dicarboxylate,dimethylcis-4-cyclohexene-1,2-dicarboxylate,1r, 6s-methyl 6-methoxycarbonyl-3-cyclohexenecarboxylate,4-cyclohexene-1alpha,2alpha-dicarboxylic acid dimethyl ester,1,2-dimethyl 1r,2s-cyclohex-4-ene-1,2-dicarboxylate,4-cyclohexene-1,2-dicarboxylicacid, dimethyl ester, 1r,2s-rel |
| IUPAC Name | dimethyl (1R,2S)-cyclohex-4-ene-1,2-dicarboxylate |
| InChI Key | DVVAGRMJGUQHLI-OCAPTIKFSA-N |
| Molecular Formula | C10H14O4 |
Methyl p-Tolylacetate 99.0+%, TCI America™
CAS: 23786-13-2 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD00056243 InChI Key: LSAGWGNECLEVPE-UHFFFAOYSA-N Synonym: methyl p-tolylacetate,methyl 4-methylphenylacetate,methyl 2-4-methylphenyl acetate,methyl 2-p-tolyl acetate,methylp-tolylacetate,p-methylphenylacetic acid methyl ester,methyl 4-methylphenyl acetate,p-tolylacetic acid methyl ester,4-methylphenylacetic acid methyl ester,benzeneacetic acid, 4-methyl-, methyl ester PubChem CID: 90265 IUPAC Name: methyl 2-(4-methylphenyl)acetate SMILES: COC(=O)CC1=CC=C(C)C=C1
| PubChem CID | 90265 |
|---|---|
| CAS | 23786-13-2 |
| Molecular Weight (g/mol) | 164.20 |
| MDL Number | MFCD00056243 |
| SMILES | COC(=O)CC1=CC=C(C)C=C1 |
| Synonym | methyl p-tolylacetate,methyl 4-methylphenylacetate,methyl 2-4-methylphenyl acetate,methyl 2-p-tolyl acetate,methylp-tolylacetate,p-methylphenylacetic acid methyl ester,methyl 4-methylphenyl acetate,p-tolylacetic acid methyl ester,4-methylphenylacetic acid methyl ester,benzeneacetic acid, 4-methyl-, methyl ester |
| IUPAC Name | methyl 2-(4-methylphenyl)acetate |
| InChI Key | LSAGWGNECLEVPE-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
2,2,3,3,3-Pentafluoropropyl Methacrylate (stabilized with TBC) 98.0+%, TCI America™
CAS: 45115-53-5 Molecular Formula: C7H7F5O2 Molecular Weight (g/mol): 218.123 MDL Number: MFCD00039256 InChI Key: CLISWDZSTWQFNX-UHFFFAOYSA-N Synonym: 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor PubChem CID: 123516 IUPAC Name: 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(F)(F)F)(F)F
| PubChem CID | 123516 |
|---|---|
| CAS | 45115-53-5 |
| Molecular Weight (g/mol) | 218.123 |
| MDL Number | MFCD00039256 |
| SMILES | CC(=C)C(=O)OCC(C(F)(F)F)(F)F |
| Synonym | 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate |
| InChI Key | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| Molecular Formula | C7H7F5O2 |
Butyl 4-[(4-Methoxybenzylidene)amino]cinnamate 98.0+%, TCI America™
CAS: 16833-17-3 Molecular Formula: C21H23NO3 Molecular Weight (g/mol): 337.419 MDL Number: MFCD00059871 InChI Key: CULYZFOOJBHBNM-CIZPVDQASA-N Synonym: 4-(p-Anisalamino)cinnamic Acid Butyl Ester, 4-[(p-Anisylidene)amino]cinnamic Acid Butyl Ester, Butyl 4-(p-Anisalamino)cinnamate, Butyl 4-[(p-Anisylidene)amino]cinnamate, 4-[(4-Methoxybenzylidene)amino]cinnamic Acid Butyl Ester PubChem CID: 5705753 IUPAC Name: butyl (E)-3-[4-[(4-methoxyphenyl)methylideneamino]phenyl]prop-2-enoate SMILES: CCCCOC(=O)C=CC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC
| PubChem CID | 5705753 |
|---|---|
| CAS | 16833-17-3 |
| Molecular Weight (g/mol) | 337.419 |
| MDL Number | MFCD00059871 |
| SMILES | CCCCOC(=O)C=CC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC |
| Synonym | 4-(p-Anisalamino)cinnamic Acid Butyl Ester, 4-[(p-Anisylidene)amino]cinnamic Acid Butyl Ester, Butyl 4-(p-Anisalamino)cinnamate, Butyl 4-[(p-Anisylidene)amino]cinnamate, 4-[(4-Methoxybenzylidene)amino]cinnamic Acid Butyl Ester |
| IUPAC Name | butyl (E)-3-[4-[(4-methoxyphenyl)methylideneamino]phenyl]prop-2-enoate |
| InChI Key | CULYZFOOJBHBNM-CIZPVDQASA-N |
| Molecular Formula | C21H23NO3 |
Ethyl 4,4,4-Trifluorocrotonate 98.0+%, TCI America™
CAS: 25597-16-4 Molecular Formula: C6H7F3O2 Molecular Weight (g/mol): 168.12 MDL Number: MFCD00009903 InChI Key: ZKRJCMKLCDWROR-ONEGZZNKSA-N Synonym: ethyl 4,4,4-trifluorocrotonate,ethyl 2e-4,4,4-trifluorobut-2-enoate,ethyl4,4,4-trifluorocrotonate,e-ethyl 4,4,4-trifluorobut-2-enoate,4,4,4-trifluorocrotonic acid ethyl ester,ethyl e-4,4,4-trifluorobut-2-enoate,ethyl-4,4,4-trifluorocrotonate,ethyl 4,4,4-trifluorobut-2-enoate,4,4,4-trifluoro-but-2-enoic acid ethyl ester,2-butenoic acid, 4,4,4-trifluoro-, ethyl ester, 2e PubChem CID: 5371261 IUPAC Name: ethyl (2E)-4,4,4-trifluorobut-2-enoate SMILES: CCOC(=O)\C=C\C(F)(F)F
| PubChem CID | 5371261 |
|---|---|
| CAS | 25597-16-4 |
| Molecular Weight (g/mol) | 168.12 |
| MDL Number | MFCD00009903 |
| SMILES | CCOC(=O)\C=C\C(F)(F)F |
| Synonym | ethyl 4,4,4-trifluorocrotonate,ethyl 2e-4,4,4-trifluorobut-2-enoate,ethyl4,4,4-trifluorocrotonate,e-ethyl 4,4,4-trifluorobut-2-enoate,4,4,4-trifluorocrotonic acid ethyl ester,ethyl e-4,4,4-trifluorobut-2-enoate,ethyl-4,4,4-trifluorocrotonate,ethyl 4,4,4-trifluorobut-2-enoate,4,4,4-trifluoro-but-2-enoic acid ethyl ester,2-butenoic acid, 4,4,4-trifluoro-, ethyl ester, 2e |
| IUPAC Name | ethyl (2E)-4,4,4-trifluorobut-2-enoate |
| InChI Key | ZKRJCMKLCDWROR-ONEGZZNKSA-N |
| Molecular Formula | C6H7F3O2 |
Methyl Benzimidazole-5-carboxylate 98.0+%, TCI America™
CAS: 26663-77-4 Molecular Formula: C9H8N2O2 Molecular Weight (g/mol): 176.175 MDL Number: MFCD03407310 InChI Key: WJHHIVYNOVTVGY-UHFFFAOYSA-N Synonym: methyl benzimidazole-5-carboxylate,methyl 1h-benzimidazole-5-carboxylate,methyl 1h-benzo d imidazole-5-carboxylate,methyl 1h-1,3-benzodiazole-5-carboxylate,1h-benzimidazole-5-carboxylicacidmethylester,1h-benzimidazole-5-carboxylic acid methyl ester,methyl 1h-benzo d imidazole-6-carboxylate,benzimidazole-5-carboxylic acid methyl ester,1h-benzoimidazole-5-carboxylic acid methyl ester,1h-benzimidazole-5-carboxylic acid, methyl ester PubChem CID: 2779733 IUPAC Name: methyl 3H-benzimidazole-5-carboxylate SMILES: COC(=O)C1=CC2=C(C=C1)N=CN2
| PubChem CID | 2779733 |
|---|---|
| CAS | 26663-77-4 |
| Molecular Weight (g/mol) | 176.175 |
| MDL Number | MFCD03407310 |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=CN2 |
| Synonym | methyl benzimidazole-5-carboxylate,methyl 1h-benzimidazole-5-carboxylate,methyl 1h-benzo d imidazole-5-carboxylate,methyl 1h-1,3-benzodiazole-5-carboxylate,1h-benzimidazole-5-carboxylicacidmethylester,1h-benzimidazole-5-carboxylic acid methyl ester,methyl 1h-benzo d imidazole-6-carboxylate,benzimidazole-5-carboxylic acid methyl ester,1h-benzoimidazole-5-carboxylic acid methyl ester,1h-benzimidazole-5-carboxylic acid, methyl ester |
| IUPAC Name | methyl 3H-benzimidazole-5-carboxylate |
| InChI Key | WJHHIVYNOVTVGY-UHFFFAOYSA-N |
| Molecular Formula | C9H8N2O2 |
Methyl Chloroglyoxylate 98.0+%, TCI America™
CAS: 5781-53-3 Molecular Formula: C3H3ClO3 Molecular Weight (g/mol): 122.504 MDL Number: MFCD00000705 InChI Key: ZXUQEPZWVQIOJE-UHFFFAOYSA-N Synonym: methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate PubChem CID: 79846 IUPAC Name: methyl 2-chloro-2-oxoacetate SMILES: COC(=O)C(=O)Cl
| PubChem CID | 79846 |
|---|---|
| CAS | 5781-53-3 |
| Molecular Weight (g/mol) | 122.504 |
| MDL Number | MFCD00000705 |
| SMILES | COC(=O)C(=O)Cl |
| Synonym | methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate |
| IUPAC Name | methyl 2-chloro-2-oxoacetate |
| InChI Key | ZXUQEPZWVQIOJE-UHFFFAOYSA-N |
| Molecular Formula | C3H3ClO3 |
Methyl 2,3-Dichloropropionate 95.0+%, TCI America™
CAS: 3674-09-7 Molecular Formula: C4H6Cl2O2 Molecular Weight (g/mol): 156.99 MDL Number: MFCD00000944 InChI Key: OFHMODDLBXETIK-UHFFFAOYNA-N Synonym: methyl 2,3-dichloropropionate,propanoic acid, 2,3-dichloro-, methyl ester,2,3-dichloropropionic acid methyl ester,methyl-2,3-dichloropropionate,methyl alpha,beta-dichloropropionate,methyl .alpha.,.beta.-dichloropropionate,propionic acid, 2,3-dichloro-, methyl ester,propanoic acid,3-dichloro-, methyl ester,propionic acid,3-dichloro-, methyl ester,methyl-2,3-dichloropropioate PubChem CID: 95429 IUPAC Name: methyl 2,3-dichloropropanoate SMILES: COC(=O)C(CCl)Cl
| PubChem CID | 95429 |
|---|---|
| CAS | 3674-09-7 |
| Molecular Weight (g/mol) | 156.99 |
| MDL Number | MFCD00000944 |
| SMILES | COC(=O)C(CCl)Cl |
| Synonym | methyl 2,3-dichloropropionate,propanoic acid, 2,3-dichloro-, methyl ester,2,3-dichloropropionic acid methyl ester,methyl-2,3-dichloropropionate,methyl alpha,beta-dichloropropionate,methyl .alpha.,.beta.-dichloropropionate,propionic acid, 2,3-dichloro-, methyl ester,propanoic acid,3-dichloro-, methyl ester,propionic acid,3-dichloro-, methyl ester,methyl-2,3-dichloropropioate |
| IUPAC Name | methyl 2,3-dichloropropanoate |
| InChI Key | OFHMODDLBXETIK-UHFFFAOYNA-N |
| Molecular Formula | C4H6Cl2O2 |
2-Methoxyethyl p-Toluenesulfonate 98.0+%, TCI America™
CAS: 17178-10-8 Molecular Formula: C10H14O4S Molecular Weight (g/mol): 230.28 MDL Number: MFCD00025910 InChI Key: TZXJJSAQSRHKCZ-UHFFFAOYSA-N Synonym: p-Toluenesulfonic Acid 2-Methoxyethyl Ester PubChem CID: 86977 IUPAC Name: 2-methoxyethyl 4-methylbenzene-1-sulfonate SMILES: COCCOS(=O)(=O)C1=CC=C(C)C=C1
| PubChem CID | 86977 |
|---|---|
| CAS | 17178-10-8 |
| Molecular Weight (g/mol) | 230.28 |
| MDL Number | MFCD00025910 |
| SMILES | COCCOS(=O)(=O)C1=CC=C(C)C=C1 |
| Synonym | p-Toluenesulfonic Acid 2-Methoxyethyl Ester |
| IUPAC Name | 2-methoxyethyl 4-methylbenzene-1-sulfonate |
| InChI Key | TZXJJSAQSRHKCZ-UHFFFAOYSA-N |
| Molecular Formula | C10H14O4S |
(S)-(+)-2,2-Dimethyl-1,3-dioxolan-4-ylmethyl p-Toluenesulfonate 98.0+%, TCI America™
CAS: 23735-43-5 Molecular Formula: C13H18O5S Molecular Weight (g/mol): 286.342 MDL Number: MFCD00063234 InChI Key: SRKDUHUULIWXFT-NSHDSACASA-N Synonym: s-+-2,2-dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate,s-2,2-dimethyl-1,3-dioxolan-4-yl methyl 4-methylbenzenesulfonate,4s-2,2-dimethyl-1,3-dioxolan-4-yl methyl 4-methylbenzenesulfonate,s-+-2,2-dimethyl-1,3-dioxolane-4-ylmethyl p-toluenesulfonate,s-2,2-dimethyl-1,3-dioxolane-4-methanol p-toluenesulfonate,r---2,2-dimethyl-1,3-dioxolane-4-ylmethyl-p-toluenesulfonate,pubchem6795,2,2-dimethyl-1,3-dioxolan-4-yl methyl 4-methylbenzenesulfonate #,s-2,2-dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate PubChem CID: 2723760 IUPAC Name: [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate SMILES: CC1=CC=C(C=C1)S(=O)(=O)OCC2COC(O2)(C)C
| PubChem CID | 2723760 |
|---|---|
| CAS | 23735-43-5 |
| Molecular Weight (g/mol) | 286.342 |
| MDL Number | MFCD00063234 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2COC(O2)(C)C |
| Synonym | s-+-2,2-dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate,s-2,2-dimethyl-1,3-dioxolan-4-yl methyl 4-methylbenzenesulfonate,4s-2,2-dimethyl-1,3-dioxolan-4-yl methyl 4-methylbenzenesulfonate,s-+-2,2-dimethyl-1,3-dioxolane-4-ylmethyl p-toluenesulfonate,s-2,2-dimethyl-1,3-dioxolane-4-methanol p-toluenesulfonate,r---2,2-dimethyl-1,3-dioxolane-4-ylmethyl-p-toluenesulfonate,pubchem6795,2,2-dimethyl-1,3-dioxolan-4-yl methyl 4-methylbenzenesulfonate #,s-2,2-dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| InChI Key | SRKDUHUULIWXFT-NSHDSACASA-N |
| Molecular Formula | C13H18O5S |
2-[2-(2,2,2-Trifluoroethoxy)phenoxy]ethyl Methanesulfonate 98.0+%, TCI America™
CAS: 160969-03-9 Molecular Formula: C11H13F3O5S Molecular Weight (g/mol): 314.275 MDL Number: MFCD16038209 InChI Key: HOJMCBMXHWZNKX-UHFFFAOYSA-N Synonym: Methanesulfonic Acid 2-[2-(2,2,2-Trifluoroethoxy)phenoxy]ethyl Ester PubChem CID: 10519307 IUPAC Name: 2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl methanesulfonate SMILES: CS(=O)(=O)OCCOC1=CC=CC=C1OCC(F)(F)F
| PubChem CID | 10519307 |
|---|---|
| CAS | 160969-03-9 |
| Molecular Weight (g/mol) | 314.275 |
| MDL Number | MFCD16038209 |
| SMILES | CS(=O)(=O)OCCOC1=CC=CC=C1OCC(F)(F)F |
| Synonym | Methanesulfonic Acid 2-[2-(2,2,2-Trifluoroethoxy)phenoxy]ethyl Ester |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl methanesulfonate |
| InChI Key | HOJMCBMXHWZNKX-UHFFFAOYSA-N |
| Molecular Formula | C11H13F3O5S |
Benzenesulfonic Anhydride 96.0+%, TCI America™
CAS: 512-35-6 Molecular Formula: C12H10O5S2 Molecular Weight (g/mol): 298.327 MDL Number: MFCD00054601 InChI Key: MLWPJXZKQOPTKZ-UHFFFAOYSA-N PubChem CID: 11335509 IUPAC Name: benzenesulfonyl benzenesulfonate SMILES: C1=CC=C(C=C1)S(=O)(=O)OS(=O)(=O)C2=CC=CC=C2
| PubChem CID | 11335509 |
|---|---|
| CAS | 512-35-6 |
| Molecular Weight (g/mol) | 298.327 |
| MDL Number | MFCD00054601 |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OS(=O)(=O)C2=CC=CC=C2 |
| IUPAC Name | benzenesulfonyl benzenesulfonate |
| InChI Key | MLWPJXZKQOPTKZ-UHFFFAOYSA-N |
| Molecular Formula | C12H10O5S2 |
2-Thiophenesulfonamide 98.0+%, TCI America™
CAS: 6339-87-3 Molecular Formula: C4H5NO2S2 Molecular Weight (g/mol): 163.209 MDL Number: MFCD00185853 InChI Key: KTFDYVNEGTXQCV-UHFFFAOYSA-N PubChem CID: 72881 ChEBI: CHEBI:79403 IUPAC Name: thiophene-2-sulfonamide SMILES: C1=CSC(=C1)S(=O)(=O)N
| PubChem CID | 72881 |
|---|---|
| CAS | 6339-87-3 |
| Molecular Weight (g/mol) | 163.209 |
| ChEBI | CHEBI:79403 |
| MDL Number | MFCD00185853 |
| SMILES | C1=CSC(=C1)S(=O)(=O)N |
| IUPAC Name | thiophene-2-sulfonamide |
| InChI Key | KTFDYVNEGTXQCV-UHFFFAOYSA-N |
| Molecular Formula | C4H5NO2S2 |
Methyl 4-Cyanobenzoate 98.0+%, TCI America™
CAS: 1129-35-7 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 MDL Number: MFCD00001823 InChI Key: KKZMIDYKRKGJHG-UHFFFAOYSA-N Synonym: 4-cyanobenzoic acid methyl ester,benzoic acid, 4-cyano-, methyl ester,methyl p-cyanobenzoate,unii-f8fms7o8xg,f8fms7o8xg,benzoic acid, p-cyano-, methyl ester,4-cyano-benzoic acid methyl ester,methyl4-cyanobenzoate,methyl-4-cyanobenzoate,acmc-1bs5i PubChem CID: 70791 IUPAC Name: methyl 4-cyanobenzoate SMILES: COC(=O)C1=CC=C(C=C1)C#N
| PubChem CID | 70791 |
|---|---|
| CAS | 1129-35-7 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD00001823 |
| SMILES | COC(=O)C1=CC=C(C=C1)C#N |
| Synonym | 4-cyanobenzoic acid methyl ester,benzoic acid, 4-cyano-, methyl ester,methyl p-cyanobenzoate,unii-f8fms7o8xg,f8fms7o8xg,benzoic acid, p-cyano-, methyl ester,4-cyano-benzoic acid methyl ester,methyl4-cyanobenzoate,methyl-4-cyanobenzoate,acmc-1bs5i |
| IUPAC Name | methyl 4-cyanobenzoate |
| InChI Key | KKZMIDYKRKGJHG-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |